C8H13FO4S — CID 105481717
3-(1,1-dioxothiolan-3-yl)-3-fluorobutanoic acid (PubChem CID 105481717) has the molecular formula C8H13FO4S and a molecular weight of 224.25 g/mol. Its IUPAC name is 3-(1,1-dioxothiolan-3-yl)-3-fluorobutanoic acid.
| Compound Name | 3-(1,1-dioxothiolan-3-yl)-3-fluorobutanoic acid |
|---|---|
| PubChem CID | 105481717 |
| Molecular Formula | C8H13FO4S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 3-(1,1-dioxothiolan-3-yl)-3-fluorobutanoic acid |
| SMILES | CC(F)(CC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13FO4S/c1-8(9,4-7(10)11)6-2-3-14(12,13)5-6/h6H,2-5H2,1H3,(H,10,11) |
| InChIKey | ISWZLOJKTPEFEU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |