C11H13ClN2O — CID 105482606
1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine (PubChem CID 105482606) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine.
| Compound Name | 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 105482606 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine |
| SMILES | CNC(C)Cc1onc2c(Cl)cccc12 |
| InChI | InChI=1S/C11H13ClN2O/c1-7(13-2)6-10-8-4-3-5-9(12)11(8)14-15-10/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | XXYSEUXLSQVGML-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |