About 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine
1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine (PubChem CID 105482606) has the molecular formula C11H13ClN2O
and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine.
Molecular Properties
| Compound Name | 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine |
| PubChem CID | 105482606 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine |
| SMILES | CNC(C)Cc1onc2c(Cl)cccc12 |
| InChI | InChI=1S/C11H13ClN2O/c1-7(13-2)6-10-8-4-3-5-9(12)11(8)14-15-10/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | XXYSEUXLSQVGML-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine?
The IUPAC name of 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine (CID 105482606) is 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine.
What is the SMILES notation for 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine?
The canonical SMILES for 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine is CNC(C)Cc1onc2c(Cl)cccc12.
What is the InChIKey of 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine?
The InChIKey is XXYSEUXLSQVGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O/c1-7(13-2)6-10-8-4-3-5-9(12)11(8)14-15-10/h3-5,7,13H,6H2,1-2H3.
What are the key properties of 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine?
1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine has a molecular weight of 224.69 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chloro-2,1-benzoxazol-3-yl)-N-methylpropan-2-amine is sourced from PubChem (CID 105482606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).