C12H24BNO2 — CID 105482748
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-amine (PubChem CID 105482748) has the molecular formula C12H24BNO2 and a molecular weight of 225.14 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-amine.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 105482748 |
| Molecular Formula | C12H24BNO2 |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-amine |
| SMILES | CC1(C)OB(C2CCCCC2N)OC1(C)C |
| InChI | InChI=1S/C12H24BNO2/c1-11(2)12(3,4)16-13(15-11)9-7-5-6-8-10(9)14/h9-10H,5-8,14H2,1-4H3 |
| InChIKey | WGJPWQMYTPKEBN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|