C23H45B2O4Si — CID 137258545
CID 137258545 (PubChem CID 137258545) has the molecular formula C23H45B2O4Si and a molecular weight of 435.32 g/mol.
| Compound Name | CID 137258545 |
|---|---|
| PubChem CID | 137258545 |
| Molecular Formula | C23H45B2O4Si |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 435.33 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)CC1[C@@H](B2OC(C)(C)C(C)(C)O2)CCC[C@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H45B2O4Si/c1-11-30(12-2)16-17-18(24-26-20(3,4)21(5,6)27-24)14-13-15-19(17)25-28-22(7,8)23(9,10)29-25/h17-19H,11-16H2,1-10H3/t17?,18-,19+ |
| InChIKey | GGIRSYURVLGLLG-YQQQUEKLSA-N |
| XLogP | 6.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|