C10H21BO3Si — CID 175414609
[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxysilane (PubChem CID 175414609) has the molecular formula C10H21BO3Si and a molecular weight of 228.17 g/mol. Its IUPAC name is [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxysilane.
| Compound Name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxysilane |
|---|---|
| PubChem CID | 175414609 |
| Molecular Formula | C10H21BO3Si |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxysilane |
| SMILES | CC1(C)OB(C2CC2CO[SiH3])OC1(C)C |
| InChI | InChI=1S/C10H21BO3Si/c1-9(2)10(3,4)14-11(13-9)8-5-7(8)6-12-15/h7-8H,5-6H2,1-4,15H3 |
| InChIKey | FPMXNYPUSMMHJV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|