C7H10F2O4S — CID 105485247
methyl 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetate (PubChem CID 105485247) has the molecular formula C7H10F2O4S and a molecular weight of 228.22 g/mol. Its IUPAC name is methyl 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetate.
| Compound Name | methyl 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 105485247 |
| Molecular Formula | C7H10F2O4S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | methyl 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroacetate |
| SMILES | COC(=O)C(F)(F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H10F2O4S/c1-13-6(10)7(8,9)5-2-3-14(11,12)4-5/h5H,2-4H2,1H3 |
| InChIKey | PFZONJPIELZZDL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |