C10H19NO5 — CID 105492435
methyl 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate (PubChem CID 105492435) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is methyl 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate.
| Compound Name | methyl 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate |
|---|---|
| PubChem CID | 105492435 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | methyl 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropanoate |
| SMILES | COC(=O)C(C)CONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO5/c1-7(8(12)14-5)6-15-11-9(13)16-10(2,3)4/h7H,6H2,1-5H3,(H,11,13) |
| InChIKey | HZMJPIZKLZRAHJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|