C12H25NO7 — CID 90296833
tert-butyl N-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxyheptoxy]carbamate (PubChem CID 90296833) has the molecular formula C12H25NO7 and a molecular weight of 295.33 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxyheptoxy]carbamate.
| Compound Name | tert-butyl N-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxyheptoxy]carbamate |
|---|---|
| PubChem CID | 90296833 |
| Molecular Formula | C12H25NO7 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | tert-butyl N-[(2R,3R,4R,5R)-2,3,4,5-tetrahydroxyheptoxy]carbamate |
| SMILES | CC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25NO7/c1-5-7(14)9(16)10(17)8(15)6-19-13-11(18)20-12(2,3)4/h7-10,14-17H,5-6H2,1-4H3,(H,13,18)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | UDWYKCPIZBZIAV-ZYUZMQFOSA-N |
| XLogP | -0.70 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|