C13H25ClN2O5 — CID 15153709
tert-butyl N-[2-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropyl]carbamate (PubChem CID 15153709) has the molecular formula C13H25ClN2O5 and a molecular weight of 324.81 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[2-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropyl]carbamate |
|---|---|
| PubChem CID | 15153709 |
| Molecular Formula | C13H25ClN2O5 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl N-[2-chloro-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(Cl)CONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25ClN2O5/c1-12(2,3)20-10(17)15-7-9(14)8-19-16-11(18)21-13(4,5)6/h9H,7-8H2,1-6H3,(H,15,17)(H,16,18) |
| InChIKey | NGFGNZQLVUSMBW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|