C22H24ClN5O — CID 10549490
[2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]triazol-4-yl]-phenylmethanone (PubChem CID 10549490) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is [2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]triazol-4-yl]-phenylmethanone.
| Compound Name | [2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]triazol-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10549490 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]triazol-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1cnn(CCCN2CCN(c3ccccc3Cl)CC2)n1 |
| InChI | InChI=1S/C22H24ClN5O/c23-19-9-4-5-10-21(19)27-15-13-26(14-16-27)11-6-12-28-24-17-20(25-28)22(29)18-7-2-1-3-8-18/h1-5,7-10,17H,6,11-16H2 |
| InChIKey | FQTXGHQVPKBXRT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |