About 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide
3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide (PubChem CID 105498718) has the molecular formula C5H5BrN2O2S
and a molecular weight of 237.08 g/mol. Its IUPAC name is 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide.
Analyze 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide?
The IUPAC name of 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide (CID 105498718) is 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide.
What is the SMILES notation for 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide?
The canonical SMILES for 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide is O=S1(=O)Cc2[nH]nc(Br)c2C1.
What is the InChIKey of 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide?
The InChIKey is MQVJRAXIELBNDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2O2S/c6-5-3-1-11(9,10)2-4(3)7-8-5/h1-2H2,(H,7,8).
What are the key properties of 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide?
3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide has a molecular weight of 237.08 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4,6-dihydro-1H-thieno[3,4-d]pyrazole 5,5-dioxide is sourced from PubChem (CID 105498718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).