About 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole
3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole (PubChem CID 105473451) has the molecular formula C6H7BrN2S
and a molecular weight of 219.11 g/mol. Its IUPAC name is 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole.
Analyze 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole?
The IUPAC name of 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole (CID 105473451) is 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole.
What is the SMILES notation for 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole?
The canonical SMILES for 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole is Brc1n[nH]c2c1CCSC2.
What is the InChIKey of 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole?
The InChIKey is IGHICEMHEGZASO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2S/c7-6-4-1-2-10-3-5(4)8-9-6/h1-3H2,(H,8,9).
What are the key properties of 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole?
3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole has a molecular weight of 219.11 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,4,5,7-tetrahydrothiopyrano[4,3-d]pyrazole is sourced from PubChem (CID 105473451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).