C5H5ClN2S — CID 83191676
3-chloro-4,6-dihydro-1H-thieno[3,4-d]pyrazole (PubChem CID 83191676) has the molecular formula C5H5ClN2S and a molecular weight of 160.63 g/mol. Its IUPAC name is 3-chloro-4,6-dihydro-1H-thieno[3,4-d]pyrazole.
| Compound Name | 3-chloro-4,6-dihydro-1H-thieno[3,4-d]pyrazole |
|---|---|
| PubChem CID | 83191676 |
| Molecular Formula | C5H5ClN2S |
| Molecular Weight | 160.63 g/mol |
| Exact Mass | 159.99 |
| IUPAC Name | 3-chloro-4,6-dihydro-1H-thieno[3,4-d]pyrazole |
| SMILES | Clc1n[nH]c2c1CSC2 |
| InChI | InChI=1S/C5H5ClN2S/c6-5-3-1-9-2-4(3)7-8-5/h1-2H2,(H,7,8) |
| InChIKey | LLUJSZVQQRNIBV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |