C20H22N2O4S2 — CID 10549963
7,10,13,16-tetraoxa-3,20-dithia-27,28-diazatetracyclo[20.3.1.12,5.118,21]octacosa-1(26),2(28),4,18,21(27),22,24-heptaene (PubChem CID 10549963) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 7,10,13,16-tetraoxa-3,20-dithia-27,28-diazatetracyclo[20.3.1.12,5.118,21]octacosa-1(26),2(28),4,18,21(27),22,24-heptaene.
| Compound Name | 7,10,13,16-tetraoxa-3,20-dithia-27,28-diazatetracyclo[20.3.1.12,5.118,21]octacosa-1(26),2(28),4,18,21(27),22,24-heptaene |
|---|---|
| PubChem CID | 10549963 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 7,10,13,16-tetraoxa-3,20-dithia-27,28-diazatetracyclo[20.3.1.12,5.118,21]octacosa-1(26),2(28),4,18,21(27),22,24-heptaene |
| SMILES | c1cc2cc(c1)-c1nc(cs1)COCCOCCOCCOCc1csc-2n1 |
| InChI | InChI=1S/C20H22N2O4S2/c1-2-15-10-16(3-1)20-22-18(14-28-20)12-26-9-7-24-5-4-23-6-8-25-11-17-13-27-19(15)21-17/h1-3,10,13-14H,4-9,11-12H2 |
| InChIKey | PUQGHNMNVMJVLX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |