C22H36N4O5 — CID 10550993
(2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-4-oxo-4-piperidin-1-yl-2-[(3,4,4-trimethyl-2,5-dioxo-(514C)1,3-diazolidin-1-yl)methyl]butanamide (PubChem CID 10550993) has the molecular formula C22H36N4O5 and a molecular weight of 438.55 g/mol. Its IUPAC name is (2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-4-oxo-4-piperidin-1-yl-2-[(3,4,4-trimethyl-2,5-dioxo-(514C)1,3-diazolidin-1-yl)methyl]butanamide.
| Compound Name | (2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-4-oxo-4-piperidin-1-yl-2-[(3,4,4-trimethyl-2,5-dioxo-(514C)1,3-diazolidin-1-yl)methyl]butanamide |
|---|---|
| PubChem CID | 10550993 |
| Molecular Formula | C22H36N4O5 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-4-oxo-4-piperidin-1-yl-2-[(3,4,4-trimethyl-2,5-dioxo-(514C)1,3-diazolidin-1-yl)methyl]butanamide |
| SMILES | CN1C(=O)N(C[C@H](C(=O)NO)[C@@H](CC2CCCC2)C(=O)N2CCCCC2)[14C](=O)C1(C)C |
| InChI | InChI=1S/C22H36N4O5/c1-22(2)20(29)26(21(30)24(22)3)14-17(18(27)23-31)16(13-15-9-5-6-10-15)19(28)25-11-7-4-8-12-25/h15-17,31H,4-14H2,1-3H3,(H,23,27)/t16-,17+/m1/s1/i20+2 |
| InChIKey | GFUITADOEPNRML-QPEJBIBOSA-N |
| XLogP | 1.99 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|