C29H40N4O6 — CID 10840302
[[(2R,3R)-3-(cyclopentylmethyl)-4-oxo-4-(2,3,4,5,6-pentadeuteriopiperidin-1-yl)-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanoyl]amino] benzoate (PubChem CID 10840302) has the molecular formula C29H40N4O6 and a molecular weight of 545.69 g/mol. Its IUPAC name is [[(2R,3R)-3-(cyclopentylmethyl)-4-oxo-4-(2,3,4,5,6-pentadeuteriopiperidin-1-yl)-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanoyl]amino] benzoate.
| Compound Name | [[(2R,3R)-3-(cyclopentylmethyl)-4-oxo-4-(2,3,4,5,6-pentadeuteriopiperidin-1-yl)-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanoyl]amino] benzoate |
|---|---|
| PubChem CID | 10840302 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | [[(2R,3R)-3-(cyclopentylmethyl)-4-oxo-4-(2,3,4,5,6-pentadeuteriopiperidin-1-yl)-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanoyl]amino] benzoate |
| SMILES | [2H]C1C([2H])C([2H])N(C(=O)[C@H](CC2CCCC2)[C@H](CN2C(=O)N(C)C(C)(C)C2=O)C(=O)NOC(=O)c2ccccc2)C([2H])C1[2H] |
| InChI | InChI=1S/C29H40N4O6/c1-29(2)27(37)33(28(38)31(29)3)19-23(24(34)30-39-26(36)21-14-6-4-7-15-21)22(18-20-12-8-9-13-20)25(35)32-16-10-5-11-17-32/h4,6-7,14-15,20,22-23H,5,8-13,16-19H2,1-3H3,(H,30,34)/t22-,23+/m1/s1/i5D,10D,11D,16D,17D/t5?,10?,11?,16?,17?,22-,23+ |
| InChIKey | RQAQDIMMBMLGJN-MRXIGPHLSA-N |
| XLogP | 3.37 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|