C23H38N4O3 — CID 89240937
(3R)-3-(cyclopentylmethyl)-N-hydroxy-4-piperidin-1-yl-2-(3,4,4-trimethyl-2-methylidene-5-oxoimidazolidin-1-yl)pent-4-enamide (PubChem CID 89240937) has the molecular formula C23H38N4O3 and a molecular weight of 418.58 g/mol. Its IUPAC name is (3R)-3-(cyclopentylmethyl)-N-hydroxy-4-piperidin-1-yl-2-(3,4,4-trimethyl-2-methylidene-5-oxoimidazolidin-1-yl)pent-4-enamide.
| Compound Name | (3R)-3-(cyclopentylmethyl)-N-hydroxy-4-piperidin-1-yl-2-(3,4,4-trimethyl-2-methylidene-5-oxoimidazolidin-1-yl)pent-4-enamide |
|---|---|
| PubChem CID | 89240937 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (3R)-3-(cyclopentylmethyl)-N-hydroxy-4-piperidin-1-yl-2-(3,4,4-trimethyl-2-methylidene-5-oxoimidazolidin-1-yl)pent-4-enamide |
| SMILES | C=C([C@H](CC1CCCC1)C(C(=O)NO)N1C(=C)N(C)C(C)(C)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C23H38N4O3/c1-16(26-13-9-6-10-14-26)19(15-18-11-7-8-12-18)20(21(28)24-30)27-17(2)25(5)23(3,4)22(27)29/h18-20,30H,1-2,6-15H2,3-5H3,(H,24,28)/t19-,20?/m0/s1 |
| InChIKey | VDFVORYRZGSMAY-XJDOXCRVSA-N |
| XLogP | 3.08 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|