C17H28N2O2 — CID 110876675
(4aR,8aR)-4a-(azepane-1-carbonyl)-1-methyl-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one (PubChem CID 110876675) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4aR,8aR)-4a-(azepane-1-carbonyl)-1-methyl-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one.
| Compound Name | (4aR,8aR)-4a-(azepane-1-carbonyl)-1-methyl-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one |
|---|---|
| PubChem CID | 110876675 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (4aR,8aR)-4a-(azepane-1-carbonyl)-1-methyl-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one |
| SMILES | CN1C(=O)CC[C@]2(C(=O)N3CCCCCC3)CCCC[C@@H]12 |
| InChI | InChI=1S/C17H28N2O2/c1-18-14-8-4-5-10-17(14,11-9-15(18)20)16(21)19-12-6-2-3-7-13-19/h14H,2-13H2,1H3/t14-,17-/m1/s1 |
| InChIKey | SNXPHFKMFZFKTE-RHSMWYFYSA-N |
| XLogP | 2.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |