C22H36N2O4 — CID 156611154
4a-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-1-(3-methylbutyl)-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one (PubChem CID 156611154) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is 4a-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-1-(3-methylbutyl)-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one.
| Compound Name | 4a-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-1-(3-methylbutyl)-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one |
|---|---|
| PubChem CID | 156611154 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 4a-(1,4-dioxa-8-azaspiro[4.5]decane-8-carbonyl)-1-(3-methylbutyl)-4,5,6,7,8,8a-hexahydro-3H-quinolin-2-one |
| SMILES | CC(C)CCN1C(=O)CCC2(C(=O)N3CCC4(CC3)OCCO4)CCCCC12 |
| InChI | InChI=1S/C22H36N2O4/c1-17(2)7-12-24-18-5-3-4-8-21(18,9-6-19(24)25)20(26)23-13-10-22(11-14-23)27-15-16-28-22/h17-18H,3-16H2,1-2H3 |
| InChIKey | XWINJYDZLRQKGD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |