C12H19NO3 — CID 129493702
(4aS,8aR)-1-ethyl-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxylic acid (PubChem CID 129493702) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (4aS,8aR)-1-ethyl-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxylic acid.
| Compound Name | (4aS,8aR)-1-ethyl-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxylic acid |
|---|---|
| PubChem CID | 129493702 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (4aS,8aR)-1-ethyl-2-oxo-4,5,6,7,8,8a-hexahydro-3H-quinoline-4a-carboxylic acid |
| SMILES | CCN1C(=O)CC[C@@]2(C(=O)O)CCCC[C@@H]12 |
| InChI | InChI=1S/C12H19NO3/c1-2-13-9-5-3-4-7-12(9,11(15)16)8-6-10(13)14/h9H,2-8H2,1H3,(H,15,16)/t9-,12+/m1/s1 |
| InChIKey | QRKGXFSNSGJAGN-SKDRFNHKSA-N |
| XLogP | 1.64 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |