C26H36N4O5S — CID 54323980
(2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-2-[[isoquinolin-5-ylsulfonyl(methyl)amino]methyl]-4-oxo-4-piperidin-1-ylbutanamide (PubChem CID 54323980) has the molecular formula C26H36N4O5S and a molecular weight of 516.66 g/mol. Its IUPAC name is (2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-2-[[isoquinolin-5-ylsulfonyl(methyl)amino]methyl]-4-oxo-4-piperidin-1-ylbutanamide.
| Compound Name | (2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-2-[[isoquinolin-5-ylsulfonyl(methyl)amino]methyl]-4-oxo-4-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 54323980 |
| Molecular Formula | C26H36N4O5S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (2R,3R)-3-(cyclopentylmethyl)-N-hydroxy-2-[[isoquinolin-5-ylsulfonyl(methyl)amino]methyl]-4-oxo-4-piperidin-1-ylbutanamide |
| SMILES | CN(C[C@H](C(=O)NO)[C@@H](CC1CCCC1)C(=O)N1CCCCC1)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C26H36N4O5S/c1-29(36(34,35)24-11-7-10-20-17-27-13-12-21(20)24)18-23(25(31)28-33)22(16-19-8-3-4-9-19)26(32)30-14-5-2-6-15-30/h7,10-13,17,19,22-23,33H,2-6,8-9,14-16,18H2,1H3,(H,28,31)/t22-,23+/m1/s1 |
| InChIKey | STPTUHGEPUARPX-PKTZIBPZSA-N |
| XLogP | 3.19 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|