C20H29N3O2S — CID 71376939
N-(4-aminobutyl)-N-(2-cyclopentylethyl)isoquinoline-5-sulfonamide (PubChem CID 71376939) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-(2-cyclopentylethyl)isoquinoline-5-sulfonamide.
| Compound Name | N-(4-aminobutyl)-N-(2-cyclopentylethyl)isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 71376939 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-(4-aminobutyl)-N-(2-cyclopentylethyl)isoquinoline-5-sulfonamide |
| SMILES | NCCCCN(CCC1CCCC1)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C20H29N3O2S/c21-12-3-4-14-23(15-11-17-6-1-2-7-17)26(24,25)20-9-5-8-18-16-22-13-10-19(18)20/h5,8-10,13,16-17H,1-4,6-7,11-12,14-15,21H2 |
| InChIKey | YHBDQBINZIJQON-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|