C25H38N2O3S — CID 21278414
N-hexyl-N-(2-oxodecyl)isoquinoline-5-sulfonamide (PubChem CID 21278414) has the molecular formula C25H38N2O3S and a molecular weight of 446.66 g/mol. Its IUPAC name is N-hexyl-N-(2-oxodecyl)isoquinoline-5-sulfonamide.
| Compound Name | N-hexyl-N-(2-oxodecyl)isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 21278414 |
| Molecular Formula | C25H38N2O3S |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | N-hexyl-N-(2-oxodecyl)isoquinoline-5-sulfonamide |
| SMILES | CCCCCCCCC(=O)CN(CCCCCC)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C25H38N2O3S/c1-3-5-7-9-10-11-15-23(28)21-27(19-12-8-6-4-2)31(29,30)25-16-13-14-22-20-26-18-17-24(22)25/h13-14,16-18,20H,3-12,15,19,21H2,1-2H3 |
| InChIKey | ZVSRTHIBZQXWQU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|