C21H33N3O2S — CID 14326799
N-(1-aminohexan-2-yl)-N-hexylisoquinoline-5-sulfonamide (PubChem CID 14326799) has the molecular formula C21H33N3O2S and a molecular weight of 391.58 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-N-hexylisoquinoline-5-sulfonamide.
| Compound Name | N-(1-aminohexan-2-yl)-N-hexylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 14326799 |
| Molecular Formula | C21H33N3O2S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-(1-aminohexan-2-yl)-N-hexylisoquinoline-5-sulfonamide |
| SMILES | CCCCCCN(C(CN)CCCC)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C21H33N3O2S/c1-3-5-7-8-15-24(19(16-22)11-6-4-2)27(25,26)21-12-9-10-18-17-23-14-13-20(18)21/h9-10,12-14,17,19H,3-8,11,15-16,22H2,1-2H3 |
| InChIKey | ZWFJDHFTNASZAE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|