C24H39N3O2S — CID 70054324
N-(3-aminononyl)-N-hexylisoquinoline-5-sulfonamide (PubChem CID 70054324) has the molecular formula C24H39N3O2S and a molecular weight of 433.66 g/mol. Its IUPAC name is N-(3-aminononyl)-N-hexylisoquinoline-5-sulfonamide.
| Compound Name | N-(3-aminononyl)-N-hexylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 70054324 |
| Molecular Formula | C24H39N3O2S |
| Molecular Weight | 433.66 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-(3-aminononyl)-N-hexylisoquinoline-5-sulfonamide |
| SMILES | CCCCCCC(N)CCN(CCCCCC)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C24H39N3O2S/c1-3-5-7-9-13-22(25)16-19-27(18-10-8-6-4-2)30(28,29)24-14-11-12-21-20-26-17-15-23(21)24/h11-12,14-15,17,20,22H,3-10,13,16,18-19,25H2,1-2H3 |
| InChIKey | NWAXREHJRGDAEQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.66 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|