About 1-chloropentyl isoquinoline-5-sulfonate
1-chloropentyl isoquinoline-5-sulfonate (PubChem CID 174951174) has the molecular formula C14H16ClNO3S
and a molecular weight of 313.81 g/mol. Its IUPAC name is 1-chloropentyl isoquinoline-5-sulfonate.
Molecular Properties
| Compound Name | 1-chloropentyl isoquinoline-5-sulfonate |
| PubChem CID | 174951174 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-chloropentyl isoquinoline-5-sulfonate |
| SMILES | CCCCC(Cl)OS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C14H16ClNO3S/c1-2-3-7-14(15)19-20(17,18)13-6-4-5-11-10-16-9-8-12(11)13/h4-6,8-10,14H,2-3,7H2,1H3 |
| InChIKey | GASUULOCIMPEQH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentyl isoquinoline-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentyl isoquinoline-5-sulfonate?
The IUPAC name of 1-chloropentyl isoquinoline-5-sulfonate (CID 174951174) is 1-chloropentyl isoquinoline-5-sulfonate.
What is the SMILES notation for 1-chloropentyl isoquinoline-5-sulfonate?
The canonical SMILES for 1-chloropentyl isoquinoline-5-sulfonate is CCCCC(Cl)OS(=O)(=O)c1cccc2cnccc12.
What is the InChIKey of 1-chloropentyl isoquinoline-5-sulfonate?
The InChIKey is GASUULOCIMPEQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClNO3S/c1-2-3-7-14(15)19-20(17,18)13-6-4-5-11-10-16-9-8-12(11)13/h4-6,8-10,14H,2-3,7H2,1H3.
What are the key properties of 1-chloropentyl isoquinoline-5-sulfonate?
1-chloropentyl isoquinoline-5-sulfonate has a molecular weight of 313.81 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentyl isoquinoline-5-sulfonate is sourced from PubChem (CID 174951174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).