C19H29N3O2S — CID 14326788
N-(4-aminobutyl)-N-hexylisoquinoline-5-sulfonamide (PubChem CID 14326788) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-hexylisoquinoline-5-sulfonamide.
| Compound Name | N-(4-aminobutyl)-N-hexylisoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 14326788 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-(4-aminobutyl)-N-hexylisoquinoline-5-sulfonamide |
| SMILES | CCCCCCN(CCCCN)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C19H29N3O2S/c1-2-3-4-6-14-22(15-7-5-12-20)25(23,24)19-10-8-9-17-16-21-13-11-18(17)19/h8-11,13,16H,2-7,12,14-15,20H2,1H3 |
| InChIKey | UXBQTLKYDDXRSM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|