C24H29ClN4O2S — CID 67862169
N-(4-aminobutyl)-N-[2-[3-(4-chlorophenyl)prop-2-enylamino]ethyl]isoquinoline-5-sulfonamide (PubChem CID 67862169) has the molecular formula C24H29ClN4O2S and a molecular weight of 473.04 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-[2-[3-(4-chlorophenyl)prop-2-enylamino]ethyl]isoquinoline-5-sulfonamide.
| Compound Name | N-(4-aminobutyl)-N-[2-[3-(4-chlorophenyl)prop-2-enylamino]ethyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 67862169 |
| Molecular Formula | C24H29ClN4O2S |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-(4-aminobutyl)-N-[2-[3-(4-chlorophenyl)prop-2-enylamino]ethyl]isoquinoline-5-sulfonamide |
| SMILES | NCCCCN(CCNCC=Cc1ccc(Cl)cc1)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C24H29ClN4O2S/c25-22-10-8-20(9-11-22)5-4-14-27-16-18-29(17-2-1-13-26)32(30,31)24-7-3-6-21-19-28-15-12-23(21)24/h3-12,15,19,27H,1-2,13-14,16-18,26H2 |
| InChIKey | SXTQZSHHUVLSNM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|