C33H32N4O5S2 — CID 144649079
[4-[2-[isoquinolin-5-ylsulfinyl(methyl)amino]-3-oxo-3-piperidin-1-ylpropyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 144649079) has the molecular formula C33H32N4O5S2 and a molecular weight of 628.78 g/mol. Its IUPAC name is [4-[2-[isoquinolin-5-ylsulfinyl(methyl)amino]-3-oxo-3-piperidin-1-ylpropyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[2-[isoquinolin-5-ylsulfinyl(methyl)amino]-3-oxo-3-piperidin-1-ylpropyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 144649079 |
| Molecular Formula | C33H32N4O5S2 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | [4-[2-[isoquinolin-5-ylsulfinyl(methyl)amino]-3-oxo-3-piperidin-1-ylpropyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | CN(C(Cc1ccc(OS(=O)(=O)c2cccc3cnccc23)cc1)C(=O)N1CCCCC1)S(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C33H32N4O5S2/c1-36(43(39)31-9-5-7-25-22-34-17-15-28(25)31)30(33(38)37-19-3-2-4-20-37)21-24-11-13-27(14-12-24)42-44(40,41)32-10-6-8-26-23-35-18-16-29(26)32/h5-18,22-23,30H,2-4,19-21H2,1H3 |
| InChIKey | USMXAMOONYBVBL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|