C33H32N4O6S2 — CID 19796283
[4-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]-3-(4-oxopiperidin-1-yl)propyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 19796283) has the molecular formula C33H32N4O6S2 and a molecular weight of 644.78 g/mol. Its IUPAC name is [4-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]-3-(4-oxopiperidin-1-yl)propyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]-3-(4-oxopiperidin-1-yl)propyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 19796283 |
| Molecular Formula | C33H32N4O6S2 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | [4-[2-[isoquinolin-5-ylsulfonyl(methyl)amino]-3-(4-oxopiperidin-1-yl)propyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | CN(C(Cc1ccc(OS(=O)(=O)c2cccc3cnccc23)cc1)CN1CCC(=O)CC1)S(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C33H32N4O6S2/c1-36(44(39,40)32-6-2-4-25-21-34-16-12-30(25)32)27(23-37-18-14-28(38)15-19-37)20-24-8-10-29(11-9-24)43-45(41,42)33-7-3-5-26-22-35-17-13-31(26)33/h2-13,16-17,21-22,27H,14-15,18-20,23H2,1H3 |
| InChIKey | WPOCDSUMTQMTIB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 126.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|