C38H37N5O5S2 — CID 142631967
[4-[2-(isoquinolin-5-ylsulfonylamino)-3-(4-phenyl-1,4-diazepan-1-yl)propyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 142631967) has the molecular formula C38H37N5O5S2 and a molecular weight of 707.88 g/mol. Its IUPAC name is [4-[2-(isoquinolin-5-ylsulfonylamino)-3-(4-phenyl-1,4-diazepan-1-yl)propyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[2-(isoquinolin-5-ylsulfonylamino)-3-(4-phenyl-1,4-diazepan-1-yl)propyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 142631967 |
| Molecular Formula | C38H37N5O5S2 |
| Molecular Weight | 707.88 g/mol |
| Exact Mass | 707.22 |
| IUPAC Name | [4-[2-(isoquinolin-5-ylsulfonylamino)-3-(4-phenyl-1,4-diazepan-1-yl)propyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | O=S(=O)(NC(Cc1ccc(OS(=O)(=O)c2cccc3cnccc23)cc1)CN1CCCN(c2ccccc2)CC1)c1cccc2cnccc12 |
| InChI | InChI=1S/C38H37N5O5S2/c44-49(45,37-11-4-7-30-26-39-19-17-35(30)37)41-32(28-42-21-6-22-43(24-23-42)33-9-2-1-3-10-33)25-29-13-15-34(16-14-29)48-50(46,47)38-12-5-8-31-27-40-20-18-36(31)38/h1-5,7-20,26-27,32,41H,6,21-25,28H2 |
| InChIKey | KDSKRDGGSVKXRJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.88 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|