C26H32Cl2N4O3S — CID 19764628
N-[1-[4-(4-cyanophenoxy)butyl]piperidin-4-yl]-N-methylisoquinoline-5-sulfonamide;dihydrochloride (PubChem CID 19764628) has the molecular formula C26H32Cl2N4O3S and a molecular weight of 551.54 g/mol. Its IUPAC name is N-[1-[4-(4-cyanophenoxy)butyl]piperidin-4-yl]-N-methylisoquinoline-5-sulfonamide;dihydrochloride.
| Compound Name | N-[1-[4-(4-cyanophenoxy)butyl]piperidin-4-yl]-N-methylisoquinoline-5-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 19764628 |
| Molecular Formula | C26H32Cl2N4O3S |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | N-[1-[4-(4-cyanophenoxy)butyl]piperidin-4-yl]-N-methylisoquinoline-5-sulfonamide;dihydrochloride |
| SMILES | CN(C1CCN(CCCCOc2ccc(C#N)cc2)CC1)S(=O)(=O)c1cccc2cnccc12.Cl.Cl |
| InChI | InChI=1S/C26H30N4O3S.2ClH/c1-29(34(31,32)26-6-4-5-22-20-28-14-11-25(22)26)23-12-16-30(17-13-23)15-2-3-18-33-24-9-7-21(19-27)8-10-24;;/h4-11,14,20,23H,2-3,12-13,15-18H2,1H3;2*1H |
| InChIKey | RZQWTTMNNMMXGO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|