C31H25N5O4S — CID 142737929
[4-[3-[1-(4-cyanobenzoyl)piperidin-4-yl]imidazol-4-yl]phenyl] isoquinoline-5-sulfonate (PubChem CID 142737929) has the molecular formula C31H25N5O4S and a molecular weight of 563.64 g/mol. Its IUPAC name is [4-[3-[1-(4-cyanobenzoyl)piperidin-4-yl]imidazol-4-yl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[3-[1-(4-cyanobenzoyl)piperidin-4-yl]imidazol-4-yl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 142737929 |
| Molecular Formula | C31H25N5O4S |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | [4-[3-[1-(4-cyanobenzoyl)piperidin-4-yl]imidazol-4-yl]phenyl] isoquinoline-5-sulfonate |
| SMILES | N#Cc1ccc(C(=O)N2CCC(n3cncc3-c3ccc(OS(=O)(=O)c4cccc5cnccc45)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H25N5O4S/c32-18-22-4-6-24(7-5-22)31(37)35-16-13-26(14-17-35)36-21-34-20-29(36)23-8-10-27(11-9-23)40-41(38,39)30-3-1-2-25-19-33-15-12-28(25)30/h1-12,15,19-21,26H,13-14,16-17H2 |
| InChIKey | BZRIMXJWYBCORJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 118.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|