C35H37BrN4O6S — CID 142714074
[4-[[3-[1-(adamantane-1-carbonyl)-3-bromopiperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 142714074) has the molecular formula C35H37BrN4O6S and a molecular weight of 721.67 g/mol. Its IUPAC name is [4-[[3-[1-(adamantane-1-carbonyl)-3-bromopiperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[[3-[1-(adamantane-1-carbonyl)-3-bromopiperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 142714074 |
| Molecular Formula | C35H37BrN4O6S |
| Molecular Weight | 721.67 g/mol |
| Exact Mass | 720.16 |
| IUPAC Name | [4-[[3-[1-(adamantane-1-carbonyl)-3-bromopiperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | O=C1NC(=O)N(C2CCN(C(=O)C34CC5CC(CC(C5)C3)C4)CC2Br)C1Cc1ccc(OS(=O)(=O)c2cccc3cnccc23)cc1 |
| InChI | InChI=1S/C35H37BrN4O6S/c36-28-20-39(33(42)35-16-22-12-23(17-35)14-24(13-22)18-35)11-9-29(28)40-30(32(41)38-34(40)43)15-21-4-6-26(7-5-21)46-47(44,45)31-3-1-2-25-19-37-10-8-27(25)31/h1-8,10,19,22-24,28-30H,9,11-18,20H2,(H,38,41,43) |
| InChIKey | XACQHUDEJHNGRX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|