C33H36N4O6S — CID 118733193
[4-[[3-[1-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 118733193) has the molecular formula C33H36N4O6S and a molecular weight of 616.74 g/mol. Its IUPAC name is [4-[[3-[1-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[[3-[1-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 118733193 |
| Molecular Formula | C33H36N4O6S |
| Molecular Weight | 616.74 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | [4-[[3-[1-[2-(2-bicyclo[2.2.1]heptanyl)acetyl]piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | O=C1NC(=O)N(C2CCN(C(=O)CC3CC4CCC3C4)CC2)C1Cc1ccc(OS(=O)(=O)c2cccc3cnccc23)cc1 |
| InChI | InChI=1S/C33H36N4O6S/c38-31(19-25-17-22-4-7-23(25)16-22)36-14-11-26(12-15-36)37-29(32(39)35-33(37)40)18-21-5-8-27(9-6-21)43-44(41,42)30-3-1-2-24-20-34-13-10-28(24)30/h1-3,5-6,8-10,13,20,22-23,25-26,29H,4,7,11-12,14-19H2,(H,35,39,40) |
| InChIKey | AFNWPGDONRDFEE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|