C17H12N2O3S — CID 142737908
1H-indol-5-yl isoquinoline-5-sulfonate (PubChem CID 142737908) has the molecular formula C17H12N2O3S and a molecular weight of 324.36 g/mol. Its IUPAC name is 1H-indol-5-yl isoquinoline-5-sulfonate.
| Compound Name | 1H-indol-5-yl isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 142737908 |
| Molecular Formula | C17H12N2O3S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1H-indol-5-yl isoquinoline-5-sulfonate |
| SMILES | O=S(=O)(Oc1ccc2[nH]ccc2c1)c1cccc2cnccc12 |
| InChI | InChI=1S/C17H12N2O3S/c20-23(21,17-3-1-2-13-11-18-8-7-15(13)17)22-14-4-5-16-12(10-14)6-9-19-16/h1-11,19H |
| InChIKey | FMSKYLBEILDHJX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|