C29H37FN2O3 — CID 10552747
(4R,5S,6S)-4-benzyl-1,3-bis(cyclopropylmethyl)-6-[(1S)-1-fluoro-2-phenylethyl]-5-(methoxymethoxy)-1,3-diazinan-2-one (PubChem CID 10552747) has the molecular formula C29H37FN2O3 and a molecular weight of 480.62 g/mol. Its IUPAC name is (4R,5S,6S)-4-benzyl-1,3-bis(cyclopropylmethyl)-6-[(1S)-1-fluoro-2-phenylethyl]-5-(methoxymethoxy)-1,3-diazinan-2-one.
| Compound Name | (4R,5S,6S)-4-benzyl-1,3-bis(cyclopropylmethyl)-6-[(1S)-1-fluoro-2-phenylethyl]-5-(methoxymethoxy)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 10552747 |
| Molecular Formula | C29H37FN2O3 |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | (4R,5S,6S)-4-benzyl-1,3-bis(cyclopropylmethyl)-6-[(1S)-1-fluoro-2-phenylethyl]-5-(methoxymethoxy)-1,3-diazinan-2-one |
| SMILES | COCO[C@@H]1[C@@H]([C@@H](F)Cc2ccccc2)N(CC2CC2)C(=O)N(CC2CC2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H37FN2O3/c1-34-20-35-28-26(17-22-10-6-3-7-11-22)31(18-23-12-13-23)29(33)32(19-24-14-15-24)27(28)25(30)16-21-8-4-2-5-9-21/h2-11,23-28H,12-20H2,1H3/t25-,26+,27+,28-/m0/s1 |
| InChIKey | XSJYKZUPIXAPRC-HFLBTKGNSA-N |
| XLogP | 5.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|