C39H60F2N2O5Si2 — CID 10771235
(4R,5S,6S,7R)-1,3-bis(cyclopropylmethyl)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one (PubChem CID 10771235) has the molecular formula C39H60F2N2O5Si2 and a molecular weight of 731.09 g/mol. Its IUPAC name is (4R,5S,6S,7R)-1,3-bis(cyclopropylmethyl)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-1,3-bis(cyclopropylmethyl)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 10771235 |
| Molecular Formula | C39H60F2N2O5Si2 |
| Molecular Weight | 731.09 g/mol |
| Exact Mass | 730.40 |
| IUPAC Name | (4R,5S,6S,7R)-1,3-bis(cyclopropylmethyl)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
| SMILES | C[Si](C)(C)CCOCO[C@@H]1[C@@H](OCOCC[Si](C)(C)C)[C@@H](Cc2ccc(F)cc2)N(CC2CC2)C(=O)N(CC2CC2)[C@@H]1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C39H60F2N2O5Si2/c1-49(2,3)21-19-45-27-47-37-35(23-29-11-15-33(40)16-12-29)42(25-31-7-8-31)39(44)43(26-32-9-10-32)36(24-30-13-17-34(41)18-14-30)38(37)48-28-46-20-22-50(4,5)6/h11-18,31-32,35-38H,7-10,19-28H2,1-6H3/t35-,36-,37+,38+/m1/s1 |
| InChIKey | FZPCDPIJRPCCNK-RNATXAOGSA-N |
| XLogP | 8.44 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.09 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|