C27H36F2N2O7 — CID 59032184
(4R,5S,6S,7R)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one (PubChem CID 59032184) has the molecular formula C27H36F2N2O7 and a molecular weight of 538.59 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 59032184 |
| Molecular Formula | C27H36F2N2O7 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-bis[(4-fluorophenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-1,3-diazepan-2-one |
| SMILES | COCCOCO[C@@H]1[C@@H](OCOCCOC)[C@@H](Cc2ccc(F)cc2)NC(=O)N[C@@H]1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C27H36F2N2O7/c1-33-11-13-35-17-37-25-23(15-19-3-7-21(28)8-4-19)30-27(32)31-24(16-20-5-9-22(29)10-6-20)26(25)38-18-36-14-12-34-2/h3-10,23-26H,11-18H2,1-2H3,(H2,30,31,32)/t23-,24-,25+,26+/m1/s1 |
| InChIKey | RNTOUISIVWROIS-XPGKHFPBSA-N |
| XLogP | 2.81 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|