C23H27F3N2O3 — CID 12067247
N-[(1R)-1-[(4S,5S)-5-[(1R)-1-amino-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide (PubChem CID 12067247) has the molecular formula C23H27F3N2O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[(1R)-1-[(4S,5S)-5-[(1R)-1-amino-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R)-1-[(4S,5S)-5-[(1R)-1-amino-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 12067247 |
| Molecular Formula | C23H27F3N2O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[(1R)-1-[(4S,5S)-5-[(1R)-1-amino-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)O[C@@H]([C@H](N)Cc2ccccc2)[C@H]([C@@H](Cc2ccccc2)NC(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C23H27F3N2O3/c1-22(2)30-19(17(27)13-15-9-5-3-6-10-15)20(31-22)18(28-21(29)23(24,25)26)14-16-11-7-4-8-12-16/h3-12,17-20H,13-14,27H2,1-2H3,(H,28,29)/t17-,18-,19+,20+/m1/s1 |
| InChIKey | PGBYMZNIZZKJFR-ZRNYENFQSA-N |
| XLogP | 3.37 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |