C23H28F2N2O4 — CID 59032162
(4R,6S,7R)-4,7-dibenzyl-5,5-difluoro-6-(2-methoxyethoxymethoxy)-1,3-diazepan-2-one (PubChem CID 59032162) has the molecular formula C23H28F2N2O4 and a molecular weight of 434.48 g/mol. Its IUPAC name is (4R,6S,7R)-4,7-dibenzyl-5,5-difluoro-6-(2-methoxyethoxymethoxy)-1,3-diazepan-2-one.
| Compound Name | (4R,6S,7R)-4,7-dibenzyl-5,5-difluoro-6-(2-methoxyethoxymethoxy)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 59032162 |
| Molecular Formula | C23H28F2N2O4 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (4R,6S,7R)-4,7-dibenzyl-5,5-difluoro-6-(2-methoxyethoxymethoxy)-1,3-diazepan-2-one |
| SMILES | COCCOCO[C@H]1[C@@H](Cc2ccccc2)NC(=O)N[C@H](Cc2ccccc2)C1(F)F |
| InChI | InChI=1S/C23H28F2N2O4/c1-29-12-13-30-16-31-21-19(14-17-8-4-2-5-9-17)26-22(28)27-20(23(21,24)25)15-18-10-6-3-7-11-18/h2-11,19-21H,12-16H2,1H3,(H2,26,27,28)/t19-,20-,21+/m1/s1 |
| InChIKey | MHCOUJSEHQVIBD-NJYVYQBISA-N |
| XLogP | 3.16 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|