C27H35F3N2O3 — CID 12067249
N-[(1R)-1-[(4S,5S)-5-[(1R)-1-(butylamino)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide (PubChem CID 12067249) has the molecular formula C27H35F3N2O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-[(1R)-1-[(4S,5S)-5-[(1R)-1-(butylamino)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R)-1-[(4S,5S)-5-[(1R)-1-(butylamino)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 12067249 |
| Molecular Formula | C27H35F3N2O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | N-[(1R)-1-[(4S,5S)-5-[(1R)-1-(butylamino)-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCN[C@H](Cc1ccccc1)[C@@H]1OC(C)(C)O[C@H]1[C@@H](Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C27H35F3N2O3/c1-4-5-16-31-21(17-19-12-8-6-9-13-19)23-24(35-26(2,3)34-23)22(32-25(33)27(28,29)30)18-20-14-10-7-11-15-20/h6-15,21-24,31H,4-5,16-18H2,1-3H3,(H,32,33)/t21-,22-,23+,24+/m1/s1 |
| InChIKey | UFPQENWSXMDNOB-LWSSLDFYSA-N |
| XLogP | 4.80 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|