C25H26F6N2O4 — CID 12067248
N-[(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-2-phenyl-1-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide (PubChem CID 12067248) has the molecular formula C25H26F6N2O4 and a molecular weight of 532.48 g/mol. Its IUPAC name is N-[(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-2-phenyl-1-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-2-phenyl-1-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 12067248 |
| Molecular Formula | C25H26F6N2O4 |
| Molecular Weight | 532.48 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | N-[(1R)-1-[(4S,5S)-2,2-dimethyl-5-[(1R)-2-phenyl-1-[(2,2,2-trifluoroacetyl)amino]ethyl]-1,3-dioxolan-4-yl]-2-phenylethyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1(C)O[C@@H]([C@@H](Cc2ccccc2)NC(=O)C(F)(F)F)[C@H]([C@@H](Cc2ccccc2)NC(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C25H26F6N2O4/c1-23(2)36-19(17(32-21(34)24(26,27)28)13-15-9-5-3-6-10-15)20(37-23)18(33-22(35)25(29,30)31)14-16-11-7-4-8-12-16/h3-12,17-20H,13-14H2,1-2H3,(H,32,34)(H,33,35)/t17-,18-,19+,20+/m1/s1 |
| InChIKey | FXKHBXYSYZASFC-ZRNYENFQSA-N |
| XLogP | 4.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |