C31H46F4N2O5Si2 — CID 10532364
(4R,5S,6S,7R)-4,7-bis[(3,4-difluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one (PubChem CID 10532364) has the molecular formula C31H46F4N2O5Si2 and a molecular weight of 658.88 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,7-bis[(3,4-difluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one.
| Compound Name | (4R,5S,6S,7R)-4,7-bis[(3,4-difluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 10532364 |
| Molecular Formula | C31H46F4N2O5Si2 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | (4R,5S,6S,7R)-4,7-bis[(3,4-difluorophenyl)methyl]-5,6-bis(2-trimethylsilylethoxymethoxy)-1,3-diazepan-2-one |
| SMILES | C[Si](C)(C)CCOCO[C@@H]1[C@@H](OCOCC[Si](C)(C)C)[C@@H](Cc2ccc(F)c(F)c2)NC(=O)N[C@@H]1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C31H46F4N2O5Si2/c1-43(2,3)13-11-39-19-41-29-27(17-21-7-9-23(32)25(34)15-21)36-31(38)37-28(18-22-8-10-24(33)26(35)16-22)30(29)42-20-40-12-14-44(4,5)6/h7-10,15-16,27-30H,11-14,17-20H2,1-6H3,(H2,36,37,38)/t27-,28-,29+,30+/m1/s1 |
| InChIKey | VPXGYLUCXRYWQR-XAZDILKDSA-N |
| XLogP | 6.47 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|