C30H50F2N2O4Si2 — CID 10698770
(2R,3S,4S,5R)-1,6-bis(4-fluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine (PubChem CID 10698770) has the molecular formula C30H50F2N2O4Si2 and a molecular weight of 596.91 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,6-bis(4-fluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine.
| Compound Name | (2R,3S,4S,5R)-1,6-bis(4-fluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine |
|---|---|
| PubChem CID | 10698770 |
| Molecular Formula | C30H50F2N2O4Si2 |
| Molecular Weight | 596.91 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | (2R,3S,4S,5R)-1,6-bis(4-fluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine |
| SMILES | C[Si](C)(C)CCOCO[C@H]([C@@H](OCOCC[Si](C)(C)C)[C@H](N)Cc1ccc(F)cc1)[C@H](N)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C30H50F2N2O4Si2/c1-39(2,3)17-15-35-21-37-29(27(33)19-23-7-11-25(31)12-8-23)30(38-22-36-16-18-40(4,5)6)28(34)20-24-9-13-26(32)14-10-24/h7-14,27-30H,15-22,33-34H2,1-6H3/t27-,28-,29+,30+/m1/s1 |
| InChIKey | IEIVRSFNUHIESB-XAZDILKDSA-N |
| XLogP | 5.80 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|