C22H30F2N2O3 — CID 22088964
3,3-difluoro-4-(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine (PubChem CID 22088964) has the molecular formula C22H30F2N2O3 and a molecular weight of 408.49 g/mol. Its IUPAC name is 3,3-difluoro-4-(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine.
| Compound Name | 3,3-difluoro-4-(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine |
|---|---|
| PubChem CID | 22088964 |
| Molecular Formula | C22H30F2N2O3 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3,3-difluoro-4-(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine |
| SMILES | COCCOCOC(C(N)Cc1ccccc1)C(F)(F)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C22H30F2N2O3/c1-27-12-13-28-16-29-21(19(25)14-17-8-4-2-5-9-17)22(23,24)20(26)15-18-10-6-3-7-11-18/h2-11,19-21H,12-16,25-26H2,1H3 |
| InChIKey | FONKOASQZBCBGR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|