C30H48F4N2O4Si2 — CID 10817825
(2R,3S,4S,5R)-1,6-bis(3,4-difluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine (PubChem CID 10817825) has the molecular formula C30H48F4N2O4Si2 and a molecular weight of 632.89 g/mol. Its IUPAC name is (2R,3S,4S,5R)-1,6-bis(3,4-difluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine.
| Compound Name | (2R,3S,4S,5R)-1,6-bis(3,4-difluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine |
|---|---|
| PubChem CID | 10817825 |
| Molecular Formula | C30H48F4N2O4Si2 |
| Molecular Weight | 632.89 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | (2R,3S,4S,5R)-1,6-bis(3,4-difluorophenyl)-3,4-bis(2-trimethylsilylethoxymethoxy)hexane-2,5-diamine |
| SMILES | C[Si](C)(C)CCOCO[C@H]([C@@H](OCOCC[Si](C)(C)C)[C@H](N)Cc1ccc(F)c(F)c1)[C@H](N)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C30H48F4N2O4Si2/c1-41(2,3)13-11-37-19-39-29(27(35)17-21-7-9-23(31)25(33)15-21)30(40-20-38-12-14-42(4,5)6)28(36)18-22-8-10-24(32)26(34)16-22/h7-10,15-16,27-30H,11-14,17-20,35-36H2,1-6H3/t27-,28-,29+,30+/m1/s1 |
| InChIKey | DOPWQLCFJPKTIA-XAZDILKDSA-N |
| XLogP | 6.08 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.89 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|