C16H30N2O2Si — CID 22089011
4-phenyl-2-(2-trimethylsilylethoxymethoxy)butane-1,3-diamine (PubChem CID 22089011) has the molecular formula C16H30N2O2Si and a molecular weight of 310.51 g/mol. Its IUPAC name is 4-phenyl-2-(2-trimethylsilylethoxymethoxy)butane-1,3-diamine.
| Compound Name | 4-phenyl-2-(2-trimethylsilylethoxymethoxy)butane-1,3-diamine |
|---|---|
| PubChem CID | 22089011 |
| Molecular Formula | C16H30N2O2Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 4-phenyl-2-(2-trimethylsilylethoxymethoxy)butane-1,3-diamine |
| SMILES | C[Si](C)(C)CCOCOC(CN)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C16H30N2O2Si/c1-21(2,3)10-9-19-13-20-16(12-17)15(18)11-14-7-5-4-6-8-14/h4-8,15-16H,9-13,17-18H2,1-3H3 |
| InChIKey | LYPCFDSXAJSDOW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|