C23H30N2O4 — CID 10692264
(4R,5R,6R)-4-benzyl-5-(2-methoxyethoxymethoxy)-6-(2-phenylethyl)-1,3-diazinan-2-one (PubChem CID 10692264) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is (4R,5R,6R)-4-benzyl-5-(2-methoxyethoxymethoxy)-6-(2-phenylethyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6R)-4-benzyl-5-(2-methoxyethoxymethoxy)-6-(2-phenylethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 10692264 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (4R,5R,6R)-4-benzyl-5-(2-methoxyethoxymethoxy)-6-(2-phenylethyl)-1,3-diazinan-2-one |
| SMILES | COCCOCO[C@@H]1[C@@H](CCc2ccccc2)NC(=O)N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H30N2O4/c1-27-14-15-28-17-29-22-20(13-12-18-8-4-2-5-9-18)24-23(26)25-21(22)16-19-10-6-3-7-11-19/h2-11,20-22H,12-17H2,1H3,(H2,24,25,26)/t20-,21-,22-/m1/s1 |
| InChIKey | YRYIBOMUKRGCTF-YPAWHYETSA-N |
| XLogP | 2.92 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|