C34H25NO3 — CID 10553287
(1R,8S,9R,11R,12S)-1'-acetyl-13-benzhydrylidenespiro[10-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene-11,3'-indole]-2'-one (PubChem CID 10553287) has the molecular formula C34H25NO3 and a molecular weight of 495.58 g/mol. Its IUPAC name is (1R,8S,9R,11R,12S)-1'-acetyl-13-benzhydrylidenespiro[10-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene-11,3'-indole]-2'-one.
| Compound Name | (1R,8S,9R,11R,12S)-1'-acetyl-13-benzhydrylidenespiro[10-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene-11,3'-indole]-2'-one |
|---|---|
| PubChem CID | 10553287 |
| Molecular Formula | C34H25NO3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (1R,8S,9R,11R,12S)-1'-acetyl-13-benzhydrylidenespiro[10-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6-triene-11,3'-indole]-2'-one |
| SMILES | CC(=O)N1C(=O)[C@]2(O[C@H]3[C@@H]2[C@H]2C(=C(c4ccccc4)c4ccccc4)[C@@H]3c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C34H25NO3/c1-20(36)35-26-19-11-10-18-25(26)34(33(35)37)31-28-23-16-8-9-17-24(23)29(32(31)38-34)30(28)27(21-12-4-2-5-13-21)22-14-6-3-7-15-22/h2-19,28-29,31-32H,1H3/t28-,29+,31+,32-,34+/m1/s1 |
| InChIKey | RERSLHBRGDTKFY-JTIWOIDISA-N |
| XLogP | 6.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |